C45H42N8O8 — CID 159410893
4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoic acid;methyl 4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoate (PubChem CID 159410893) has the molecular formula C45H42N8O8 and a molecular weight of 822.88 g/mol. Its IUPAC name is 4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoic acid;methyl 4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoate.
| Compound Name | 4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoic acid;methyl 4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 159410893 |
| Molecular Formula | C45H42N8O8 |
| Molecular Weight | 822.88 g/mol |
| Exact Mass | 822.31 |
| IUPAC Name | 4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoic acid;methyl 4-[[[3-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2nccn3c(-c4ccc(OC)c(OC)c4)cnc23)cc1.COc1ccc(-c2cnc3c(NCc4ccc(C(=O)O)cc4)nccn23)cc1OC |
| InChI | InChI=1S/C23H22N4O4.C22H20N4O4/c1-29-19-9-8-17(12-20(19)30-2)18-14-26-22-21(24-10-11-27(18)22)25-13-15-4-6-16(7-5-15)23(28)31-3;1-29-18-8-7-16(11-19(18)30-2)17-13-25-21-20(23-9-10-26(17)21)24-12-14-3-5-15(6-4-14)22(27)28/h4-12,14H,13H2,1-3H3,(H,24,25);3-11,13H,12H2,1-2H3,(H,23,24)(H,27,28) |
| InChIKey | LOOGZBKUOHZSSJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 184.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.88 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |