About carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole
carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole (PubChem CID 159419387) has the molecular formula C20H12FNO2S2
and a molecular weight of 381.45 g/mol. Its IUPAC name is carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole |
| PubChem CID | 159419387 |
| Molecular Formula | C20H12FNO2S2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole |
| SMILES | Fc1ccc(-c2cccc(-c3csc(-c4cccs4)n3)c2)cc1.O=C=O |
| InChI | InChI=1S/C19H12FNS2.CO2/c20-16-8-6-13(7-9-16)14-3-1-4-15(11-14)17-12-23-19(21-17)18-5-2-10-22-18;2-1-3/h1-12H; |
| InChIKey | LPOLQVWSVQUKEA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole?
The IUPAC name of carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole (CID 159419387) is carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole.
What is the SMILES notation for carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole?
The canonical SMILES for carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole is Fc1ccc(-c2cccc(-c3csc(-c4cccs4)n3)c2)cc1.O=C=O.
What is the InChIKey of carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole?
The InChIKey is LPOLQVWSVQUKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12FNS2.CO2/c20-16-8-6-13(7-9-16)14-3-1-4-15(11-14)17-12-23-19(21-17)18-5-2-10-22-18;2-1-3/h1-12H;.
What are the key properties of carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole?
carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole has a molecular weight of 381.45 g/mol, XLogP of 5.76, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-[3-(4-fluorophenyl)phenyl]-2-thiophen-2-yl-1,3-thiazole is sourced from PubChem (CID 159419387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).