C23H33N3O2 — CID 159423751
1-[(2S)-3-(4-hydroxyphenyl)-2-pyrrolidin-1-ylpropyl]-3-(2-phenylethyl)urea;methane (PubChem CID 159423751) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[(2S)-3-(4-hydroxyphenyl)-2-pyrrolidin-1-ylpropyl]-3-(2-phenylethyl)urea;methane.
| Compound Name | 1-[(2S)-3-(4-hydroxyphenyl)-2-pyrrolidin-1-ylpropyl]-3-(2-phenylethyl)urea;methane |
|---|---|
| PubChem CID | 159423751 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-[(2S)-3-(4-hydroxyphenyl)-2-pyrrolidin-1-ylpropyl]-3-(2-phenylethyl)urea;methane |
| SMILES | C.O=C(NCCc1ccccc1)NC[C@H](Cc1ccc(O)cc1)N1CCCC1 |
| InChI | InChI=1S/C22H29N3O2.CH4/c26-21-10-8-19(9-11-21)16-20(25-14-4-5-15-25)17-24-22(27)23-13-12-18-6-2-1-3-7-18;/h1-3,6-11,20,26H,4-5,12-17H2,(H2,23,24,27);1H4/t20-;/m0./s1 |
| InChIKey | LQBSZKWLQSKPSX-BDQAORGHSA-N |
| XLogP | 3.58 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |