C17H32O3Si — CID 15942569
[(2E,4R)-4-tri(propan-2-yl)silyloxyhexa-2,5-dienyl] acetate (PubChem CID 15942569) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is [(2E,4R)-4-tri(propan-2-yl)silyloxyhexa-2,5-dienyl] acetate.
| Compound Name | [(2E,4R)-4-tri(propan-2-yl)silyloxyhexa-2,5-dienyl] acetate |
|---|---|
| PubChem CID | 15942569 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | [(2E,4R)-4-tri(propan-2-yl)silyloxyhexa-2,5-dienyl] acetate |
| SMILES | C=C[C@H](/C=C/COC(C)=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-9-17(11-10-12-19-16(8)18)20-21(13(2)3,14(4)5)15(6)7/h9-11,13-15,17H,1,12H2,2-8H3/b11-10+/t17-/m1/s1 |
| InChIKey | ZCLRHQDGUCFJGR-SXSDINLZSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|