C19H18ClN9 — CID 15942645
3-[(6R,8aS)-6-[2-(3-chlorophenyl)tetrazol-5-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile (PubChem CID 15942645) has the molecular formula C19H18ClN9 and a molecular weight of 407.87 g/mol. Its IUPAC name is 3-[(6R,8aS)-6-[2-(3-chlorophenyl)tetrazol-5-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[(6R,8aS)-6-[2-(3-chlorophenyl)tetrazol-5-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 15942645 |
| Molecular Formula | C19H18ClN9 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 3-[(6R,8aS)-6-[2-(3-chlorophenyl)tetrazol-5-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN2[C@@H](CC[C@@H]2c2nnn(-c3cccc(Cl)c3)n2)C1 |
| InChI | InChI=1S/C19H18ClN9/c20-13-2-1-3-14(10-13)29-25-18(24-26-29)17-5-4-15-12-27(8-9-28(15)17)19-16(11-21)22-6-7-23-19/h1-3,6-7,10,15,17H,4-5,8-9,12H2/t15-,17+/m0/s1 |
| InChIKey | SOVZWPDZKUHDRE-DOTOQJQBSA-N |
| XLogP | 2.00 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |