C33H25Cl3N8O2S — CID 159427096
2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole;2-[[4-(2-chlorophenyl)-5-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole (PubChem CID 159427096) has the molecular formula C33H25Cl3N8O2S and a molecular weight of 704.04 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole;2-[[4-(2-chlorophenyl)-5-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole;2-[[4-(2-chlorophenyl)-5-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 159427096 |
| Molecular Formula | C33H25Cl3N8O2S |
| Molecular Weight | 704.04 g/mol |
| Exact Mass | 702.09 |
| IUPAC Name | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole;2-[[4-(2-chlorophenyl)-5-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-5-(4-methylphenyl)-1,3,4-oxadiazole |
| SMILES | Cc1ccc(-c2nnc(CCl)o2)cc1.Cc1ccc(-c2nnc(CSc3nnc(-c4ccnc(Cl)c4)n3-c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C23H16Cl2N6OS.C10H9ClN2O/c1-14-6-8-15(9-7-14)22-29-27-20(32-22)13-33-23-30-28-21(16-10-11-26-19(25)12-16)31(23)18-5-3-2-4-17(18)24;1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-12H,13H2,1H3;2-5H,6H2,1H3 |
| InChIKey | LQMSFIZWAXAZSI-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 121.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.04 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|