C33H29F3N4O3 — CID 159427527
5-[2-[(2R)-5-(5-acetyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 159427527) has the molecular formula C33H29F3N4O3 and a molecular weight of 586.61 g/mol. Its IUPAC name is 5-[2-[(2R)-5-(5-acetyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-5-(5-acetyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 159427527 |
| Molecular Formula | C33H29F3N4O3 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 5-[2-[(2R)-5-(5-acetyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | CC(=O)c1nn(CC(=O)C[C@@H](Cc2cc(F)cc(F)c2)c2ncccc2-c2ccc(F)c(C(N)=O)c2)c2c1C1CCC2C1 |
| InChI | InChI=1S/C33H29F3N4O3/c1-17(41)30-29-20-4-5-21(12-20)32(29)40(39-30)16-25(42)13-22(9-18-10-23(34)15-24(35)11-18)31-26(3-2-8-38-31)19-6-7-28(36)27(14-19)33(37)43/h2-3,6-8,10-11,14-15,20-22H,4-5,9,12-13,16H2,1H3,(H2,37,43)/t20?,21?,22-/m1/s1 |
| InChIKey | CMZLUAXVZNRGMF-LZBANZJXSA-N |
| XLogP | 6.01 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |