C14H20F6O2P- — CID 159433519
1-(2,2-dimethylpropylperoxymethyl)-4-ethenylbenzene;pentafluoro-λ5-phosphane;fluoride (PubChem CID 159433519) has the molecular formula C14H20F6O2P- and a molecular weight of 365.27 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylperoxymethyl)-4-ethenylbenzene;pentafluoro-λ5-phosphane;fluoride.
| Compound Name | 1-(2,2-dimethylpropylperoxymethyl)-4-ethenylbenzene;pentafluoro-λ5-phosphane;fluoride |
|---|---|
| PubChem CID | 159433519 |
| Molecular Formula | C14H20F6O2P- |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-(2,2-dimethylpropylperoxymethyl)-4-ethenylbenzene;pentafluoro-λ5-phosphane;fluoride |
| SMILES | C=Cc1ccc(COOCC(C)(C)C)cc1.FP(F)(F)(F)F.[F-] |
| InChI | InChI=1S/C14H20O2.F5P.FH/c1-5-12-6-8-13(9-7-12)10-15-16-11-14(2,3)4;1-6(2,3,4)5;/h5-9H,1,10-11H2,2-4H3;;1H/p-1 |
| InChIKey | LRGYCWDMRYMUNW-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|