C27H24BNO2S — CID 159434789
6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-c]quinoline (PubChem CID 159434789) has the molecular formula C27H24BNO2S and a molecular weight of 437.37 g/mol. Its IUPAC name is 6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-c]quinoline.
| Compound Name | 6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 159434789 |
| Molecular Formula | C27H24BNO2S |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 6-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzothiolo[3,2-c]quinoline |
| SMILES | CC1(C)OB(c2ccc3c(c2)nc(-c2ccccc2)c2c4ccccc4sc32)OC1(C)C |
| InChI | InChI=1S/C27H24BNO2S/c1-26(2)27(3,4)31-28(30-26)18-14-15-19-21(16-18)29-24(17-10-6-5-7-11-17)23-20-12-8-9-13-22(20)32-25(19)23/h5-16H,1-4H3 |
| InChIKey | LOCPMRMAJVBOQG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|