C35H54F3N3O6 — CID 159437525
(2S)-N-[(2S,5R)-6-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-5-methyl-3,6-dioxo-1-phenylhexan-2-yl]-4-oxo-2-propan-2-yltridecanamide (PubChem CID 159437525) has the molecular formula C35H54F3N3O6 and a molecular weight of 669.83 g/mol. Its IUPAC name is (2S)-N-[(2S,5R)-6-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-5-methyl-3,6-dioxo-1-phenylhexan-2-yl]-4-oxo-2-propan-2-yltridecanamide.
| Compound Name | (2S)-N-[(2S,5R)-6-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-5-methyl-3,6-dioxo-1-phenylhexan-2-yl]-4-oxo-2-propan-2-yltridecanamide |
|---|---|
| PubChem CID | 159437525 |
| Molecular Formula | C35H54F3N3O6 |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 669.40 |
| IUPAC Name | (2S)-N-[(2S,5R)-6-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-5-methyl-3,6-dioxo-1-phenylhexan-2-yl]-4-oxo-2-propan-2-yltridecanamide |
| SMILES | CCCCCCCCCC(=O)C[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)C[C@@H](C)C(=O)NC(CCC(N)=O)C(O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C35H54F3N3O6/c1-5-6-7-8-9-10-14-17-26(42)22-27(23(2)3)34(47)41-29(21-25-15-12-11-13-16-25)30(43)20-24(4)33(46)40-28(18-19-31(39)44)32(45)35(36,37)38/h11-13,15-16,23-24,27-29,32,45H,5-10,14,17-22H2,1-4H3,(H2,39,44)(H,40,46)(H,41,47)/t24-,27+,28?,29+,32?/m1/s1 |
| InChIKey | LRTLXHXNILSXBI-NWJUBAROSA-N |
| XLogP | 5.35 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|