C37H42F3N3O6 — CID 162010154
(2S)-N-[(1S,4R)-5-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-4-methyl-2,5-dioxo-1-phenylpentyl]-4-oxo-4-(4-phenylphenyl)-2-propan-2-ylbutanamide (PubChem CID 162010154) has the molecular formula C37H42F3N3O6 and a molecular weight of 681.75 g/mol. Its IUPAC name is (2S)-N-[(1S,4R)-5-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-4-methyl-2,5-dioxo-1-phenylpentyl]-4-oxo-4-(4-phenylphenyl)-2-propan-2-ylbutanamide.
| Compound Name | (2S)-N-[(1S,4R)-5-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-4-methyl-2,5-dioxo-1-phenylpentyl]-4-oxo-4-(4-phenylphenyl)-2-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 162010154 |
| Molecular Formula | C37H42F3N3O6 |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 681.30 |
| IUPAC Name | (2S)-N-[(1S,4R)-5-[(6-amino-1,1,1-trifluoro-2-hydroxy-6-oxohexan-3-yl)amino]-4-methyl-2,5-dioxo-1-phenylpentyl]-4-oxo-4-(4-phenylphenyl)-2-propan-2-ylbutanamide |
| SMILES | CC(C)[C@H](CC(=O)c1ccc(-c2ccccc2)cc1)C(=O)N[C@H](C(=O)C[C@@H](C)C(=O)NC(CCC(N)=O)C(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C37H42F3N3O6/c1-22(2)28(21-30(44)26-16-14-25(15-17-26)24-10-6-4-7-11-24)36(49)43-33(27-12-8-5-9-13-27)31(45)20-23(3)35(48)42-29(18-19-32(41)46)34(47)37(38,39)40/h4-17,22-23,28-29,33-34,47H,18-21H2,1-3H3,(H2,41,46)(H,42,48)(H,43,49)/t23-,28+,29?,33+,34?/m1/s1 |
| InChIKey | YTIZBJOWAOUFPP-MLGSCKEOSA-N |
| XLogP | 5.32 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |