C36H42N8O6 — CID 159437931
4-cyano-N-(2-piperidin-1-ylphenyl)-1H-pyrrole-2-carboxamide;N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(hydroxymethyl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 159437931) has the molecular formula C36H42N8O6 and a molecular weight of 682.78 g/mol. Its IUPAC name is 4-cyano-N-(2-piperidin-1-ylphenyl)-1H-pyrrole-2-carboxamide;N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(hydroxymethyl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | 4-cyano-N-(2-piperidin-1-ylphenyl)-1H-pyrrole-2-carboxamide;N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(hydroxymethyl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 159437931 |
| Molecular Formula | C36H42N8O6 |
| Molecular Weight | 682.78 g/mol |
| Exact Mass | 682.32 |
| IUPAC Name | 4-cyano-N-(2-piperidin-1-ylphenyl)-1H-pyrrole-2-carboxamide;N-[2-[4-(2-hydroxyethyl)piperidin-1-yl]-5-(hydroxymethyl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | N#Cc1c[nH]c(C(=O)Nc2ccccc2N2CCCCC2)c1.O=C(Nc1cc(CO)ccc1N1CCC(CCO)CC1)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C19H24N4O5.C17H18N4O/c24-8-5-13-3-6-22(7-4-13)18-2-1-14(12-25)9-16(18)21-19(26)17-10-15(11-20-17)23(27)28;18-11-13-10-15(19-12-13)17(22)20-14-6-2-3-7-16(14)21-8-4-1-5-9-21/h1-2,9-11,13,20,24-25H,3-8,12H2,(H,21,26);2-3,6-7,10,12,19H,1,4-5,8-9H2,(H,20,22) |
| InChIKey | LRUSPEMUFQXSRR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 203.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.78 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|