C38H31BrN6O4S2 — CID 159439212
bromoethane;bis(2-(2-methylimidazo[1,2-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid) (PubChem CID 159439212) has the molecular formula C38H31BrN6O4S2 and a molecular weight of 779.74 g/mol. Its IUPAC name is bromoethane;bis(2-(2-methylimidazo[1,2-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid).
| Compound Name | bromoethane;bis(2-(2-methylimidazo[1,2-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid) |
|---|---|
| PubChem CID | 159439212 |
| Molecular Formula | C38H31BrN6O4S2 |
| Molecular Weight | 779.74 g/mol |
| Exact Mass | 778.10 |
| IUPAC Name | bromoethane;bis(2-(2-methylimidazo[1,2-a]pyridin-3-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid) |
| SMILES | CCBr.Cc1nc2ccccn2c1-c1nc(-c2ccccc2)c(C(=O)O)s1.Cc1nc2ccccn2c1-c1nc(-c2ccccc2)c(C(=O)O)s1 |
| InChI | InChI=1S/2C18H13N3O2S.C2H5Br/c2*1-11-15(21-10-6-5-9-13(21)19-11)17-20-14(16(24-17)18(22)23)12-7-3-2-4-8-12;1-2-3/h2*2-10H,1H3,(H,22,23);2H2,1H3 |
| InChIKey | LRYOERZJYGRKDR-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.74 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|