C29H27Cl4N3O3 — CID 159451011
N-benzyl-4,6-dichloro-N-methylpyridine-2-carboxamide;4,6-dichloropyridine-2-carboxylic acid;propylbenzene (PubChem CID 159451011) has the molecular formula C29H27Cl4N3O3 and a molecular weight of 607.37 g/mol. Its IUPAC name is N-benzyl-4,6-dichloro-N-methylpyridine-2-carboxamide;4,6-dichloropyridine-2-carboxylic acid;propylbenzene.
| Compound Name | N-benzyl-4,6-dichloro-N-methylpyridine-2-carboxamide;4,6-dichloropyridine-2-carboxylic acid;propylbenzene |
|---|---|
| PubChem CID | 159451011 |
| Molecular Formula | C29H27Cl4N3O3 |
| Molecular Weight | 607.37 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | N-benzyl-4,6-dichloro-N-methylpyridine-2-carboxamide;4,6-dichloropyridine-2-carboxylic acid;propylbenzene |
| SMILES | CCCc1ccccc1.CN(Cc1ccccc1)C(=O)c1cc(Cl)cc(Cl)n1.O=C(O)c1cc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C14H12Cl2N2O.C9H12.C6H3Cl2NO2/c1-18(9-10-5-3-2-4-6-10)14(19)12-7-11(15)8-13(16)17-12;1-2-6-9-7-4-3-5-8-9;7-3-1-4(6(10)11)9-5(8)2-3/h2-8H,9H2,1H3;3-5,7-8H,2,6H2,1H3;1-2H,(H,10,11) |
| InChIKey | LTJLAHRHZLJLOM-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.37 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|