C14H34N2O3 — CID 159453703
3-(tert-butylamino)propane-1,2-diol;3-(tert-butylamino)propan-1-ol (PubChem CID 159453703) has the molecular formula C14H34N2O3 and a molecular weight of 278.44 g/mol. Its IUPAC name is 3-(tert-butylamino)propane-1,2-diol;3-(tert-butylamino)propan-1-ol.
| Compound Name | 3-(tert-butylamino)propane-1,2-diol;3-(tert-butylamino)propan-1-ol |
|---|---|
| PubChem CID | 159453703 |
| Molecular Formula | C14H34N2O3 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 3-(tert-butylamino)propane-1,2-diol;3-(tert-butylamino)propan-1-ol |
| SMILES | CC(C)(C)NCC(O)CO.CC(C)(C)NCCCO |
| InChI | InChI=1S/C7H17NO2.C7H17NO/c1-7(2,3)8-4-6(10)5-9;1-7(2,3)8-5-4-6-9/h6,8-10H,4-5H2,1-3H3;8-9H,4-6H2,1-3H3 |
| InChIKey | LTRVKCPUDKOBAG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|