C14H24N4O2 — CID 159455593
1-methylimidazole;(2S)-1-(1-methylimidazol-2-yl)propan-2-ol;(2S)-2-methyloxirane (PubChem CID 159455593) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-methylimidazole;(2S)-1-(1-methylimidazol-2-yl)propan-2-ol;(2S)-2-methyloxirane.
| Compound Name | 1-methylimidazole;(2S)-1-(1-methylimidazol-2-yl)propan-2-ol;(2S)-2-methyloxirane |
|---|---|
| PubChem CID | 159455593 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-methylimidazole;(2S)-1-(1-methylimidazol-2-yl)propan-2-ol;(2S)-2-methyloxirane |
| SMILES | C[C@H](O)Cc1nccn1C.C[C@H]1CO1.Cn1ccnc1 |
| InChI | InChI=1S/C7H12N2O.C4H6N2.C3H6O/c1-6(10)5-7-8-3-4-9(7)2;1-6-3-2-5-4-6;1-3-2-4-3/h3-4,6,10H,5H2,1-2H3;2-4H,1H3;3H,2H2,1H3/t6-;;3-/m0.0/s1 |
| InChIKey | LTXVPPKXKHHNJE-RMFHETKQSA-N |
| XLogP | 1.17 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|