C11H20N2O3 — CID 79753127
1,1-diethoxy-3-(1-methylimidazol-2-yl)propan-2-ol (PubChem CID 79753127) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,1-diethoxy-3-(1-methylimidazol-2-yl)propan-2-ol.
| Compound Name | 1,1-diethoxy-3-(1-methylimidazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 79753127 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1,1-diethoxy-3-(1-methylimidazol-2-yl)propan-2-ol |
| SMILES | CCOC(OCC)C(O)Cc1nccn1C |
| InChI | InChI=1S/C11H20N2O3/c1-4-15-11(16-5-2)9(14)8-10-12-6-7-13(10)3/h6-7,9,11,14H,4-5,8H2,1-3H3 |
| InChIKey | LCLMGAGXUZMADQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|