About 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium
2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium (PubChem CID 174757497) has the molecular formula C8H18N2O3P+
and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium.
Molecular Properties
| Compound Name | 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium |
| PubChem CID | 174757497 |
| Molecular Formula | C8H18N2O3P+ |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium |
| SMILES | CC[P+](O)(O)O.CCc1nccn1C |
| InChI | InChI=1S/C6H10N2.C2H8O3P/c1-3-6-7-4-5-8(6)2;1-2-6(3,4)5/h4-5H,3H2,1-2H3;3-5H,2H2,1H3/q;+1 |
| InChIKey | LTRMKJSYMHRXKI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium?
The IUPAC name of 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium (CID 174757497) is 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium.
What is the SMILES notation for 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium?
The canonical SMILES for 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium is CC[P+](O)(O)O.CCc1nccn1C.
What is the InChIKey of 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium?
The InChIKey is LTRMKJSYMHRXKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C2H8O3P/c1-3-6-7-4-5-8(6)2;1-2-6(3,4)5/h4-5H,3H2,1-2H3;3-5H,2H2,1H3/q;+1.
What are the key properties of 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium?
2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium has a molecular weight of 221.22 g/mol, XLogP of 0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-methylimidazole;ethyl(trihydroxy)phosphanium is sourced from PubChem (CID 174757497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).