C20H32N8O — CID 66810197
1-[2-[bis[(1-methylimidazol-2-yl)methyl]amino]ethyl-[(1-methylimidazol-2-yl)methyl]amino]propan-1-ol (PubChem CID 66810197) has the molecular formula C20H32N8O and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[2-[bis[(1-methylimidazol-2-yl)methyl]amino]ethyl-[(1-methylimidazol-2-yl)methyl]amino]propan-1-ol.
| Compound Name | 1-[2-[bis[(1-methylimidazol-2-yl)methyl]amino]ethyl-[(1-methylimidazol-2-yl)methyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 66810197 |
| Molecular Formula | C20H32N8O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | 1-[2-[bis[(1-methylimidazol-2-yl)methyl]amino]ethyl-[(1-methylimidazol-2-yl)methyl]amino]propan-1-ol |
| SMILES | CCC(O)N(CCN(Cc1nccn1C)Cc1nccn1C)Cc1nccn1C |
| InChI | InChI=1S/C20H32N8O/c1-5-20(29)28(16-19-23-8-11-26(19)4)13-12-27(14-17-21-6-9-24(17)2)15-18-22-7-10-25(18)3/h6-11,20,29H,5,12-16H2,1-4H3 |
| InChIKey | DRGNKDXPUNPQCY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|