C8H15N7 — CID 174901757
2-ethyl-1-methylimidazole;N-methyl-2H-tetrazol-5-amine (PubChem CID 174901757) has the molecular formula C8H15N7 and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-ethyl-1-methylimidazole;N-methyl-2H-tetrazol-5-amine.
| Compound Name | 2-ethyl-1-methylimidazole;N-methyl-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 174901757 |
| Molecular Formula | C8H15N7 |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-ethyl-1-methylimidazole;N-methyl-2H-tetrazol-5-amine |
| SMILES | CCc1nccn1C.CNc1nn[nH]n1 |
| InChI | InChI=1S/C6H10N2.C2H5N5/c1-3-6-7-4-5-8(6)2;1-3-2-4-6-7-5-2/h4-5H,3H2,1-2H3;1H3,(H2,3,4,5,6,7) |
| InChIKey | XGDKKJNKIRAFLV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |