C20H20IN3S — CID 15945566
N-[(2-naphthalen-1-ylsulfanylphenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide (PubChem CID 15945566) has the molecular formula C20H20IN3S and a molecular weight of 461.37 g/mol. Its IUPAC name is N-[(2-naphthalen-1-ylsulfanylphenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide.
| Compound Name | N-[(2-naphthalen-1-ylsulfanylphenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 15945566 |
| Molecular Formula | C20H20IN3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[(2-naphthalen-1-ylsulfanylphenyl)methyl]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
| SMILES | I.c1ccc(Sc2cccc3ccccc23)c(CNC2=NCCN2)c1 |
| InChI | InChI=1S/C20H19N3S.HI/c1-3-9-17-15(6-1)8-5-11-19(17)24-18-10-4-2-7-16(18)14-23-20-21-12-13-22-20;/h1-11H,12-14H2,(H2,21,22,23);1H |
| InChIKey | CXTQDTVNQKHTHF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|