C13H15FO — CID 159457366
(2E,4E)-5-(4-fluorophenyl)-2,4-dimethylpenta-2,4-dien-1-ol (PubChem CID 159457366) has the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. Its IUPAC name is (2E,4E)-5-(4-fluorophenyl)-2,4-dimethylpenta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-(4-fluorophenyl)-2,4-dimethylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 159457366 |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (2E,4E)-5-(4-fluorophenyl)-2,4-dimethylpenta-2,4-dien-1-ol |
| SMILES | CC(=C\c1ccc(F)cc1)/C=C(\C)CO |
| InChI | InChI=1S/C13H15FO/c1-10(7-11(2)9-15)8-12-3-5-13(14)6-4-12/h3-8,15H,9H2,1-2H3/b10-8+,11-7+ |
| InChIKey | ARPGOAFJHWMZBQ-VTTRTIMMSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|