C55H88N6O13S2 — CID 159458474
N-(2-aminoethyl)-3,5-bis[5-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]pentanoyl]benzamide (PubChem CID 159458474) has the molecular formula C55H88N6O13S2 and a molecular weight of 1105.47 g/mol. Its IUPAC name is N-(2-aminoethyl)-3,5-bis[5-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]pentanoyl]benzamide.
| Compound Name | N-(2-aminoethyl)-3,5-bis[5-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]pentanoyl]benzamide |
|---|---|
| PubChem CID | 159458474 |
| Molecular Formula | C55H88N6O13S2 |
| Molecular Weight | 1105.47 g/mol |
| Exact Mass | 1104.59 |
| IUPAC Name | N-(2-aminoethyl)-3,5-bis[5-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]pentanoyl]benzamide |
| SMILES | NCCNC(=O)c1cc(C(=O)CCCCOCCOCCOCCCCC(=O)CCCCC2SCC3NC(=O)NC32)cc(C(=O)CCCCOCCOCCOCCCCC(=O)CCCCC2SCC3NC(=O)NC32)c1 |
| InChI | InChI=1S/C55H88N6O13S2/c56-21-22-57-53(66)42-36-40(47(64)17-7-11-25-71-29-33-73-31-27-69-23-9-5-15-43(62)13-1-3-19-49-51-45(38-75-49)58-54(67)60-51)35-41(37-42)48(65)18-8-12-26-72-30-34-74-32-28-70-24-10-6-16-44(63)14-2-4-20-50-52-46(39-76-50)59-55(68)61-52/h35-37,45-46,49-52H,1-34,38-39,56H2,(H,57,66)(H2,58,60,67)(H2,59,61,68) |
| InChIKey | LUGZUGNQSGFBST-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 261.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 76 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|