C37H33N5O2 — CID 159464775
3-methyl-6-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]-1-tritylpyrazolo[4,5-c]pyridine-4-carboxamide (PubChem CID 159464775) has the molecular formula C37H33N5O2 and a molecular weight of 579.70 g/mol. Its IUPAC name is 3-methyl-6-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]-1-tritylpyrazolo[4,5-c]pyridine-4-carboxamide.
| Compound Name | 3-methyl-6-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]-1-tritylpyrazolo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 159464775 |
| Molecular Formula | C37H33N5O2 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 3-methyl-6-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]-1-tritylpyrazolo[4,5-c]pyridine-4-carboxamide |
| SMILES | Cc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2cc(CC(=O)N[C@H](C)c3ccccc3)nc(C(N)=O)c12 |
| InChI | InChI=1S/C37H33N5O2/c1-25(27-15-7-3-8-16-27)39-33(43)24-31-23-32-34(35(40-31)36(38)44)26(2)41-42(32)37(28-17-9-4-10-18-28,29-19-11-5-12-20-29)30-21-13-6-14-22-30/h3-23,25H,24H2,1-2H3,(H2,38,44)(H,39,43)/t25-/m1/s1 |
| InChIKey | XUGOIMIPRRBDAW-RUZDIDTESA-N |
| XLogP | 6.10 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|