C23H21BrN4O4 — CID 159467877
N-(4-aminophenyl)-5-bromofuran-2-carboxamide;N-(4-aminophenyl)-3-methylfuran-2-carboxamide (PubChem CID 159467877) has the molecular formula C23H21BrN4O4 and a molecular weight of 497.35 g/mol. Its IUPAC name is N-(4-aminophenyl)-5-bromofuran-2-carboxamide;N-(4-aminophenyl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-5-bromofuran-2-carboxamide;N-(4-aminophenyl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 159467877 |
| Molecular Formula | C23H21BrN4O4 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | N-(4-aminophenyl)-5-bromofuran-2-carboxamide;N-(4-aminophenyl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1ccc(N)cc1.Nc1ccc(NC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C12H12N2O2.C11H9BrN2O2/c1-8-6-7-16-11(8)12(15)14-10-4-2-9(13)3-5-10;12-10-6-5-9(16-10)11(15)14-8-3-1-7(13)2-4-8/h2-7H,13H2,1H3,(H,14,15);1-6H,13H2,(H,14,15) |
| InChIKey | LVKNSVKGYSPXIP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|