About 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene
10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene (PubChem CID 15946868) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene.
Molecular Properties
| Compound Name | 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene |
| PubChem CID | 15946868 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene |
| SMILES | COC1=CCCC(C)(C)C12CCCO2 |
| InChI | InChI=1S/C12H20O2/c1-11(2)7-4-6-10(13-3)12(11)8-5-9-14-12/h6H,4-5,7-9H2,1-3H3 |
| InChIKey | LMQWAPGEUIELNG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene?
The IUPAC name of 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene (CID 15946868) is 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene.
What is the SMILES notation for 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene?
The canonical SMILES for 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene is COC1=CCCC(C)(C)C12CCCO2.
What is the InChIKey of 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene?
The InChIKey is LMQWAPGEUIELNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-11(2)7-4-6-10(13-3)12(11)8-5-9-14-12/h6H,4-5,7-9H2,1-3H3.
What are the key properties of 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene?
10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene has a molecular weight of 196.29 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-6,6-dimethyl-1-oxaspiro[4.5]dec-9-ene is sourced from PubChem (CID 15946868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).