About 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol
4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol (PubChem CID 159469456) has the molecular formula C23H26O3
and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol |
| PubChem CID | 159469456 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol |
| SMILES | COCc1ccc(C)c(OCc2ccccc2)c1.OCc1ccccc1 |
| InChI | InChI=1S/C16H18O2.C7H8O/c1-13-8-9-15(11-17-2)10-16(13)18-12-14-6-4-3-5-7-14;8-6-7-4-2-1-3-5-7/h3-10H,11-12H2,1-2H3;1-5,8H,6H2 |
| InChIKey | LVPQOVWXDHMRQT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol?
The IUPAC name of 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol (CID 159469456) is 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol.
What is the SMILES notation for 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol?
The canonical SMILES for 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol is COCc1ccc(C)c(OCc2ccccc2)c1.OCc1ccccc1.
What is the InChIKey of 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol?
The InChIKey is LVPQOVWXDHMRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2.C7H8O/c1-13-8-9-15(11-17-2)10-16(13)18-12-14-6-4-3-5-7-14;8-6-7-4-2-1-3-5-7/h3-10H,11-12H2,1-2H3;1-5,8H,6H2.
What are the key properties of 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol?
4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol has a molecular weight of 350.46 g/mol, XLogP of 4.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-1-methyl-2-phenylmethoxybenzene;phenylmethanol is sourced from PubChem (CID 159469456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).