C19H23NO6 — CID 15947730
ethyl 5-(2-ethoxycarbonyl-3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 15947730) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is ethyl 5-(2-ethoxycarbonyl-3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 5-(2-ethoxycarbonyl-3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 15947730 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethyl 5-(2-ethoxycarbonyl-3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C(CC1(C(=O)OCC)CC(c2ccccc2)=NO1)C(C)=O |
| InChI | InChI=1S/C19H23NO6/c1-4-24-17(22)15(13(3)21)11-19(18(23)25-5-2)12-16(20-26-19)14-9-7-6-8-10-14/h6-10,15H,4-5,11-12H2,1-3H3 |
| InChIKey | QWUXBZHKPMJKBX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|