C16H19NO4 — CID 15947731
ethyl 5-(3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 15947731) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl 5-(3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 5-(3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 15947731 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl 5-(3-oxobutyl)-3-phenyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1(CCC(C)=O)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C16H19NO4/c1-3-20-15(19)16(10-9-12(2)18)11-14(17-21-16)13-7-5-4-6-8-13/h4-8H,3,9-11H2,1-2H3 |
| InChIKey | LOXRRDCIGBJWFU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |