C29H38BN3O5 — CID 159481136
methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 159481136) has the molecular formula C29H38BN3O5 and a molecular weight of 519.45 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 159481136 |
| Molecular Formula | C29H38BN3O5 |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=Nc2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2C1)C(C)C |
| InChI | InChI=1S/C29H38BN3O5/c1-17(2)25(32-27(35)36-7)26(34)33-14-8-9-24(33)23-16-21-20-12-11-19(15-18(20)10-13-22(21)31-23)30-37-28(3,4)29(5,6)38-30/h10-13,15,17,24-25H,8-9,14,16H2,1-7H3,(H,32,35)/t24-,25-/m0/s1 |
| InChIKey | WLDAAKCJMGKSTI-DQEYMECFSA-N |
| XLogP | 4.14 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|