C9H20NO3+ — CID 159485118
methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate (PubChem CID 159485118) has the molecular formula C9H20NO3+ and a molecular weight of 190.26 g/mol. Its IUPAC name is methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate.
| Compound Name | methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate |
|---|---|
| PubChem CID | 159485118 |
| Molecular Formula | C9H20NO3+ |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate |
| SMILES | C.COC(=O)CC[N+]1(C)CCOC1 |
| InChI | InChI=1S/C8H16NO3.CH4/c1-9(5-6-12-7-9)4-3-8(10)11-2;/h3-7H2,1-2H3;1H4/q+1; |
| InChIKey | LXMFGFINKWPIKO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|