methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate

C9H20NO3+ — CID 159485118

IUPACmethane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate
SMILESC.COC(=O)CC[N+]1(C)CCOC1
InChIInChI=1S/C8H16NO3.CH4/c1-9(5-6-12-7-9)4-3-8(10)11-2;/h3-7H2,1-2H3;1H4/q+1;
InChIKeyLXMFGFINKWPIKO-UHFFFAOYSA-N
MW190.26 g/mol
LogP0.62
Rot. Bonds3

About methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate

methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate (PubChem CID 159485118) has the molecular formula C9H20NO3+ and a molecular weight of 190.26 g/mol. Its IUPAC name is methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate.

Molecular Properties

Compound Namemethane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate
PubChem CID159485118
Molecular FormulaC9H20NO3+
Molecular Weight190.26 g/mol
Exact Mass190.14
IUPAC Namemethane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate
SMILESC.COC(=O)CC[N+]1(C)CCOC1
InChIInChI=1S/C8H16NO3.CH4/c1-9(5-6-12-7-9)4-3-8(10)11-2;/h3-7H2,1-2H3;1H4/q+1;
InChIKeyLXMFGFINKWPIKO-UHFFFAOYSA-N
XLogP0.62
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.26
LogP ≤ 50.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
The IUPAC name of methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate (CID 159485118) is methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate.
What is the SMILES notation for methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
The canonical SMILES for methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate is C.COC(=O)CC[N+]1(C)CCOC1.
What is the InChIKey of methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
The InChIKey is LXMFGFINKWPIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO3.CH4/c1-9(5-6-12-7-9)4-3-8(10)11-2;/h3-7H2,1-2H3;1H4/q+1;.
What are the key properties of methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate?
methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate has a molecular weight of 190.26 g/mol, XLogP of 0.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 3-(3-methyl-1,3-oxazolidin-3-ium-3-yl)propanoate is sourced from PubChem (CID 159485118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).