C25H34N2O4 — CID 159485143
N-[(5R)-5-hydroxy-6-(4-phenylmethoxyphenoxy)hexyl]piperidine-1-carboxamide (PubChem CID 159485143) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[(5R)-5-hydroxy-6-(4-phenylmethoxyphenoxy)hexyl]piperidine-1-carboxamide.
| Compound Name | N-[(5R)-5-hydroxy-6-(4-phenylmethoxyphenoxy)hexyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 159485143 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[(5R)-5-hydroxy-6-(4-phenylmethoxyphenoxy)hexyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCCC[C@@H](O)COc1ccc(OCc2ccccc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C25H34N2O4/c28-22(11-5-6-16-26-25(29)27-17-7-2-8-18-27)20-31-24-14-12-23(13-15-24)30-19-21-9-3-1-4-10-21/h1,3-4,9-10,12-15,22,28H,2,5-8,11,16-20H2,(H,26,29)/t22-/m1/s1 |
| InChIKey | GIDRIUHLFRGEPY-JOCHJYFZSA-N |
| XLogP | 4.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|