C35H52N4O4 — CID 101042063
N-[(2S)-2-[4-[N-(3-hydroxybutyl)-4-phenylmethoxyanilino]piperidine-1-carbonyl]-3-methylbutyl]azepane-1-carboxamide (PubChem CID 101042063) has the molecular formula C35H52N4O4 and a molecular weight of 592.83 g/mol. Its IUPAC name is N-[(2S)-2-[4-[N-(3-hydroxybutyl)-4-phenylmethoxyanilino]piperidine-1-carbonyl]-3-methylbutyl]azepane-1-carboxamide.
| Compound Name | N-[(2S)-2-[4-[N-(3-hydroxybutyl)-4-phenylmethoxyanilino]piperidine-1-carbonyl]-3-methylbutyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 101042063 |
| Molecular Formula | C35H52N4O4 |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | N-[(2S)-2-[4-[N-(3-hydroxybutyl)-4-phenylmethoxyanilino]piperidine-1-carbonyl]-3-methylbutyl]azepane-1-carboxamide |
| SMILES | CC(O)CCN(c1ccc(OCc2ccccc2)cc1)C1CCN(C(=O)[C@H](CNC(=O)N2CCCCCC2)C(C)C)CC1 |
| InChI | InChI=1S/C35H52N4O4/c1-27(2)33(25-36-35(42)38-20-9-4-5-10-21-38)34(41)37-22-18-31(19-23-37)39(24-17-28(3)40)30-13-15-32(16-14-30)43-26-29-11-7-6-8-12-29/h6-8,11-16,27-28,31,33,40H,4-5,9-10,17-26H2,1-3H3,(H,36,42)/t28?,33-/m1/s1 |
| InChIKey | XRCOZYBRTKPVCA-ZBAKNJOASA-N |
| XLogP | 5.69 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|