C30H41N3O3 — CID 70064602
5-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-3-methyl-5-oxopentanamide (PubChem CID 70064602) has the molecular formula C30H41N3O3 and a molecular weight of 491.68 g/mol. Its IUPAC name is 5-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-3-methyl-5-oxopentanamide.
| Compound Name | 5-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-3-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 70064602 |
| Molecular Formula | C30H41N3O3 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | 5-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-3-methyl-5-oxopentanamide |
| SMILES | CC(CC(N)=O)CC(=O)N1CCC(N(c2ccc(OCc3ccccc3)cc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C30H41N3O3/c1-23(20-29(31)34)21-30(35)32-18-16-27(17-19-32)33(25-10-6-3-7-11-25)26-12-14-28(15-13-26)36-22-24-8-4-2-5-9-24/h2,4-5,8-9,12-15,23,25,27H,3,6-7,10-11,16-22H2,1H3,(H2,31,34) |
| InChIKey | DVVFPDBRTWYXAE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|