C35H52N4O3 — CID 90975181
N-[4-methyl-1-[3-[N-(3-methylbutyl)-4-phenylmethoxyanilino]pyrrolidin-1-yl]-1-oxopentan-2-yl]azepane-1-carboxamide (PubChem CID 90975181) has the molecular formula C35H52N4O3 and a molecular weight of 576.83 g/mol. Its IUPAC name is N-[4-methyl-1-[3-[N-(3-methylbutyl)-4-phenylmethoxyanilino]pyrrolidin-1-yl]-1-oxopentan-2-yl]azepane-1-carboxamide.
| Compound Name | N-[4-methyl-1-[3-[N-(3-methylbutyl)-4-phenylmethoxyanilino]pyrrolidin-1-yl]-1-oxopentan-2-yl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 90975181 |
| Molecular Formula | C35H52N4O3 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | N-[4-methyl-1-[3-[N-(3-methylbutyl)-4-phenylmethoxyanilino]pyrrolidin-1-yl]-1-oxopentan-2-yl]azepane-1-carboxamide |
| SMILES | CC(C)CCN(c1ccc(OCc2ccccc2)cc1)C1CCN(C(=O)C(CC(C)C)NC(=O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C35H52N4O3/c1-27(2)18-23-39(30-14-16-32(17-15-30)42-26-29-12-8-7-9-13-29)31-19-22-38(25-31)34(40)33(24-28(3)4)36-35(41)37-20-10-5-6-11-21-37/h7-9,12-17,27-28,31,33H,5-6,10-11,18-26H2,1-4H3,(H,36,41) |
| InChIKey | FJUHPSRNNCDOIA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|