C37H54N4O3 — CID 70064708
N-[1-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide (PubChem CID 70064708) has the molecular formula C37H54N4O3 and a molecular weight of 602.86 g/mol. Its IUPAC name is N-[1-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide.
| Compound Name | N-[1-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 70064708 |
| Molecular Formula | C37H54N4O3 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.42 |
| IUPAC Name | N-[1-[4-(N-cyclohexyl-4-phenylmethoxyanilino)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide |
| SMILES | CC(C)CC(NC(=O)N1CCCCCC1)C(=O)N1CCC(N(c2ccc(OCc3ccccc3)cc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C37H54N4O3/c1-29(2)27-35(38-37(43)40-23-11-3-4-12-24-40)36(42)39-25-21-33(22-26-39)41(31-15-9-6-10-16-31)32-17-19-34(20-18-32)44-28-30-13-7-5-8-14-30/h5,7-8,13-14,17-20,29,31,33,35H,3-4,6,9-12,15-16,21-28H2,1-2H3,(H,38,43) |
| InChIKey | NKJZRDPWSYZLGQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|