C28H43N3O — CID 18380852
1-(2-amino-4-methylpentyl)-N-(3-methylbutyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine (PubChem CID 18380852) has the molecular formula C28H43N3O and a molecular weight of 437.67 g/mol. Its IUPAC name is 1-(2-amino-4-methylpentyl)-N-(3-methylbutyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine.
| Compound Name | 1-(2-amino-4-methylpentyl)-N-(3-methylbutyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 18380852 |
| Molecular Formula | C28H43N3O |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | 1-(2-amino-4-methylpentyl)-N-(3-methylbutyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine |
| SMILES | CC(C)CCN(c1ccc(OCc2ccccc2)cc1)C1CCN(CC(N)CC(C)C)C1 |
| InChI | InChI=1S/C28H43N3O/c1-22(2)14-17-31(27-15-16-30(20-27)19-25(29)18-23(3)4)26-10-12-28(13-11-26)32-21-24-8-6-5-7-9-24/h5-13,22-23,25,27H,14-21,29H2,1-4H3 |
| InChIKey | RWXCYZIPLAPSJE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|