C29H43N3 — CID 54131120
(3S)-1-(2-amino-4-methylpentyl)-N-(3-methylbut-2-enyl)-N-[4-(2-phenylethyl)phenyl]pyrrolidin-3-amine (PubChem CID 54131120) has the molecular formula C29H43N3 and a molecular weight of 433.68 g/mol. Its IUPAC name is (3S)-1-(2-amino-4-methylpentyl)-N-(3-methylbut-2-enyl)-N-[4-(2-phenylethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-(2-amino-4-methylpentyl)-N-(3-methylbut-2-enyl)-N-[4-(2-phenylethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 54131120 |
| Molecular Formula | C29H43N3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.35 |
| IUPAC Name | (3S)-1-(2-amino-4-methylpentyl)-N-(3-methylbut-2-enyl)-N-[4-(2-phenylethyl)phenyl]pyrrolidin-3-amine |
| SMILES | CC(C)=CCN(c1ccc(CCc2ccccc2)cc1)[C@H]1CCN(CC(N)CC(C)C)C1 |
| InChI | InChI=1S/C29H43N3/c1-23(2)16-19-32(29-17-18-31(22-29)21-27(30)20-24(3)4)28-14-12-26(13-15-28)11-10-25-8-6-5-7-9-25/h5-9,12-16,24,27,29H,10-11,17-22,30H2,1-4H3/t27?,29-/m0/s1 |
| InChIKey | NULISYUOBDSZGO-ACEFPKFPSA-N |
| XLogP | 5.69 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|