C29H43N3O — CID 54352355
1-[(2S)-2-amino-3-methylpentyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-4-amine (PubChem CID 54352355) has the molecular formula C29H43N3O and a molecular weight of 449.68 g/mol. Its IUPAC name is 1-[(2S)-2-amino-3-methylpentyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-4-amine.
| Compound Name | 1-[(2S)-2-amino-3-methylpentyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 54352355 |
| Molecular Formula | C29H43N3O |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.34 |
| IUPAC Name | 1-[(2S)-2-amino-3-methylpentyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-4-amine |
| SMILES | CCC(C)[C@H](N)CN1CCC(N(CC=C(C)C)c2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H43N3O/c1-5-24(4)29(30)21-31-18-16-27(17-19-31)32(20-15-23(2)3)26-11-13-28(14-12-26)33-22-25-9-7-6-8-10-25/h6-15,24,27,29H,5,16-22,30H2,1-4H3/t24?,29-/m1/s1 |
| InChIKey | UGQYCWUVSVRPJS-HOINCLMKSA-N |
| XLogP | 5.88 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|