C23H30N2O — CID 10784080
N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-3-amine (PubChem CID 10784080) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-3-amine.
| Compound Name | N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 10784080 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)piperidin-3-amine |
| SMILES | CC(C)=CCN(c1ccc(OCc2ccccc2)cc1)C1CCCNC1 |
| InChI | InChI=1S/C23H30N2O/c1-19(2)14-16-25(22-9-6-15-24-17-22)21-10-12-23(13-11-21)26-18-20-7-4-3-5-8-20/h3-5,7-8,10-14,22,24H,6,9,15-18H2,1-2H3 |
| InChIKey | OWAGSUMLXYHBEF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|