C29H33ClN2O — CID 21190986
1-[(4-chlorophenyl)methyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine (PubChem CID 21190986) has the molecular formula C29H33ClN2O and a molecular weight of 461.05 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 21190986 |
| Molecular Formula | C29H33ClN2O |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(3-methylbut-2-enyl)-N-(4-phenylmethoxyphenyl)pyrrolidin-3-amine |
| SMILES | CC(C)=CCN(c1ccc(OCc2ccccc2)cc1)C1CCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C29H33ClN2O/c1-23(2)16-19-32(28-17-18-31(21-28)20-24-8-10-26(30)11-9-24)27-12-14-29(15-13-27)33-22-25-6-4-3-5-7-25/h3-16,28H,17-22H2,1-2H3 |
| InChIKey | VGBSLVDEJPDFQB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|