C27H45N3O — CID 18380778
2-amino-1-[3-[4-(3,3-dimethylbutyl)-N-(3-methylbut-2-enyl)anilino]pyrrolidin-1-yl]-4-methylpentan-1-one (PubChem CID 18380778) has the molecular formula C27H45N3O and a molecular weight of 427.68 g/mol. Its IUPAC name is 2-amino-1-[3-[4-(3,3-dimethylbutyl)-N-(3-methylbut-2-enyl)anilino]pyrrolidin-1-yl]-4-methylpentan-1-one.
| Compound Name | 2-amino-1-[3-[4-(3,3-dimethylbutyl)-N-(3-methylbut-2-enyl)anilino]pyrrolidin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 18380778 |
| Molecular Formula | C27H45N3O |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 427.36 |
| IUPAC Name | 2-amino-1-[3-[4-(3,3-dimethylbutyl)-N-(3-methylbut-2-enyl)anilino]pyrrolidin-1-yl]-4-methylpentan-1-one |
| SMILES | CC(C)=CCN(c1ccc(CCC(C)(C)C)cc1)C1CCN(C(=O)C(N)CC(C)C)C1 |
| InChI | InChI=1S/C27H45N3O/c1-20(2)13-17-30(23-10-8-22(9-11-23)12-15-27(5,6)7)24-14-16-29(19-24)26(31)25(28)18-21(3)4/h8-11,13,21,24-25H,12,14-19,28H2,1-7H3 |
| InChIKey | IKIJUIHUTPFCCY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|