C30H44ClN3O — CID 18380763
2-amino-1-[4-[4-[2-(4-chlorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-4-methylpentan-1-one (PubChem CID 18380763) has the molecular formula C30H44ClN3O and a molecular weight of 498.16 g/mol. Its IUPAC name is 2-amino-1-[4-[4-[2-(4-chlorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-4-methylpentan-1-one.
| Compound Name | 2-amino-1-[4-[4-[2-(4-chlorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 18380763 |
| Molecular Formula | C30H44ClN3O |
| Molecular Weight | 498.16 g/mol |
| Exact Mass | 497.32 |
| IUPAC Name | 2-amino-1-[4-[4-[2-(4-chlorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-4-methylpentan-1-one |
| SMILES | CC(C)CCN(c1ccc(CCc2ccc(Cl)cc2)cc1)C1CCN(C(=O)C(N)CC(C)C)CC1 |
| InChI | InChI=1S/C30H44ClN3O/c1-22(2)15-20-34(28-16-18-33(19-17-28)30(35)29(32)21-23(3)4)27-13-9-25(10-14-27)6-5-24-7-11-26(31)12-8-24/h7-14,22-23,28-29H,5-6,15-21,32H2,1-4H3 |
| InChIKey | SFRZTIYBHFTDCX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.16 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|