C30H44FN3O — CID 54493961
(2S)-2-amino-1-[4-[4-[2-(4-fluorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-3-methylpentan-1-one (PubChem CID 54493961) has the molecular formula C30H44FN3O and a molecular weight of 481.70 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[4-[2-(4-fluorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-3-methylpentan-1-one.
| Compound Name | (2S)-2-amino-1-[4-[4-[2-(4-fluorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-3-methylpentan-1-one |
|---|---|
| PubChem CID | 54493961 |
| Molecular Formula | C30H44FN3O |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 481.35 |
| IUPAC Name | (2S)-2-amino-1-[4-[4-[2-(4-fluorophenyl)ethyl]-N-(3-methylbutyl)anilino]piperidin-1-yl]-3-methylpentan-1-one |
| SMILES | CCC(C)[C@H](N)C(=O)N1CCC(N(CCC(C)C)c2ccc(CCc3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H44FN3O/c1-5-23(4)29(32)30(35)33-19-17-28(18-20-33)34(21-16-22(2)3)27-14-10-25(11-15-27)7-6-24-8-12-26(31)13-9-24/h8-15,22-23,28-29H,5-7,16-21,32H2,1-4H3/t23?,29-/m0/s1 |
| InChIKey | XXTFLEFBLGDJIY-IZCXSWDTSA-N |
| XLogP | 5.83 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|