C30H43N3O3 — CID 18380845
2-methyl-5-[4-[[N-(3-methylbutyl)-4-phenylmethoxyanilino]methyl]piperidin-1-yl]-5-oxopentanamide (PubChem CID 18380845) has the molecular formula C30H43N3O3 and a molecular weight of 493.69 g/mol. Its IUPAC name is 2-methyl-5-[4-[[N-(3-methylbutyl)-4-phenylmethoxyanilino]methyl]piperidin-1-yl]-5-oxopentanamide.
| Compound Name | 2-methyl-5-[4-[[N-(3-methylbutyl)-4-phenylmethoxyanilino]methyl]piperidin-1-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 18380845 |
| Molecular Formula | C30H43N3O3 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | 2-methyl-5-[4-[[N-(3-methylbutyl)-4-phenylmethoxyanilino]methyl]piperidin-1-yl]-5-oxopentanamide |
| SMILES | CC(C)CCN(CC1CCN(C(=O)CCC(C)C(N)=O)CC1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H43N3O3/c1-23(2)15-18-33(27-10-12-28(13-11-27)36-22-26-7-5-4-6-8-26)21-25-16-19-32(20-17-25)29(34)14-9-24(3)30(31)35/h4-8,10-13,23-25H,9,14-22H2,1-3H3,(H2,31,35) |
| InChIKey | KFLQFEQIUXSTPM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|