C26H20F2N4O6 — CID 159486228
ethyl (Z)-2-azido-3-(4-fluoro-1-benzofuran-7-yl)prop-2-enoate;ethyl 4-fluoro-6H-furo[2,3-e]indole-7-carboxylate (PubChem CID 159486228) has the molecular formula C26H20F2N4O6 and a molecular weight of 522.46 g/mol. Its IUPAC name is ethyl (Z)-2-azido-3-(4-fluoro-1-benzofuran-7-yl)prop-2-enoate;ethyl 4-fluoro-6H-furo[2,3-e]indole-7-carboxylate.
| Compound Name | ethyl (Z)-2-azido-3-(4-fluoro-1-benzofuran-7-yl)prop-2-enoate;ethyl 4-fluoro-6H-furo[2,3-e]indole-7-carboxylate |
|---|---|
| PubChem CID | 159486228 |
| Molecular Formula | C26H20F2N4O6 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | ethyl (Z)-2-azido-3-(4-fluoro-1-benzofuran-7-yl)prop-2-enoate;ethyl 4-fluoro-6H-furo[2,3-e]indole-7-carboxylate |
| SMILES | CCOC(=O)/C(=C/c1ccc(F)c2ccoc12)N=[N+]=[N-].CCOC(=O)c1cc2c(cc(F)c3ccoc32)[nH]1 |
| InChI | InChI=1S/C13H10FN3O3.C13H10FNO3/c1-2-19-13(18)11(16-17-15)7-8-3-4-10(14)9-5-6-20-12(8)9;1-2-17-13(16)11-5-8-10(15-11)6-9(14)7-3-4-18-12(7)8/h3-7H,2H2,1H3;3-6,15H,2H2,1H3/b11-7-; |
| InChIKey | LXPSPRVXRABWJU-AJULUCINSA-N |
| XLogP | 7.02 |
| TPSA | 143.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|