About magnesium;butan-1-olate;hydrogen carbonate
magnesium;butan-1-olate;hydrogen carbonate (PubChem CID 159486437) has the molecular formula C5H10MgO4
and a molecular weight of 158.44 g/mol. Its IUPAC name is magnesium;butan-1-olate;hydrogen carbonate.
Molecular Properties
| Compound Name | magnesium;butan-1-olate;hydrogen carbonate |
| PubChem CID | 159486437 |
| Molecular Formula | C5H10MgO4 |
| Molecular Weight | 158.44 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | magnesium;butan-1-olate;hydrogen carbonate |
| SMILES | CCCC[O-].O=C([O-])O.[Mg+2] |
| InChI | InChI=1S/C4H9O.CH2O3.Mg/c1-2-3-4-5;2-1(3)4;/h2-4H2,1H3;(H2,2,3,4);/q-1;;+2/p-1 |
| InChIKey | MJGSITZVKYWTSN-UHFFFAOYSA-M |
| XLogP | -1.35 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.44 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze magnesium;butan-1-olate;hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;butan-1-olate;hydrogen carbonate?
The IUPAC name of magnesium;butan-1-olate;hydrogen carbonate (CID 159486437) is magnesium;butan-1-olate;hydrogen carbonate.
What is the SMILES notation for magnesium;butan-1-olate;hydrogen carbonate?
The canonical SMILES for magnesium;butan-1-olate;hydrogen carbonate is CCCC[O-].O=C([O-])O.[Mg+2].
What is the InChIKey of magnesium;butan-1-olate;hydrogen carbonate?
The InChIKey is MJGSITZVKYWTSN-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9O.CH2O3.Mg/c1-2-3-4-5;2-1(3)4;/h2-4H2,1H3;(H2,2,3,4);/q-1;;+2/p-1.
What are the key properties of magnesium;butan-1-olate;hydrogen carbonate?
magnesium;butan-1-olate;hydrogen carbonate has a molecular weight of 158.44 g/mol, XLogP of -1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;butan-1-olate;hydrogen carbonate is sourced from PubChem (CID 159486437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).