About magnesium;butan-1-olate;octan-1-olate
magnesium;butan-1-olate;octan-1-olate (PubChem CID 24942472) has the molecular formula C12H26MgO2
and a molecular weight of 226.64 g/mol. Its IUPAC name is magnesium;butan-1-olate;octan-1-olate.
Molecular Properties
| Compound Name | magnesium;butan-1-olate;octan-1-olate |
| PubChem CID | 24942472 |
| Molecular Formula | C12H26MgO2 |
| Molecular Weight | 226.64 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | magnesium;butan-1-olate;octan-1-olate |
| SMILES | CCCCCCCC[O-].CCCC[O-].[Mg+2] |
| InChI | InChI=1S/C8H17O.C4H9O.Mg/c1-2-3-4-5-6-7-8-9;1-2-3-4-5;/h2-8H2,1H3;2-4H2,1H3;/q2*-1;+2 |
| InChIKey | VRZUGJZANQBFRT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.64 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;butan-1-olate;octan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;butan-1-olate;octan-1-olate?
The IUPAC name of magnesium;butan-1-olate;octan-1-olate (CID 24942472) is magnesium;butan-1-olate;octan-1-olate.
What is the SMILES notation for magnesium;butan-1-olate;octan-1-olate?
The canonical SMILES for magnesium;butan-1-olate;octan-1-olate is CCCCCCCC[O-].CCCC[O-].[Mg+2].
What is the InChIKey of magnesium;butan-1-olate;octan-1-olate?
The InChIKey is VRZUGJZANQBFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O.C4H9O.Mg/c1-2-3-4-5-6-7-8-9;1-2-3-4-5;/h2-8H2,1H3;2-4H2,1H3;/q2*-1;+2.
What are the key properties of magnesium;butan-1-olate;octan-1-olate?
magnesium;butan-1-olate;octan-1-olate has a molecular weight of 226.64 g/mol, XLogP of 1.47, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;butan-1-olate;octan-1-olate is sourced from PubChem (CID 24942472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).