About calcium bis(octan-1-olate)
calcium bis(octan-1-olate) (PubChem CID 87749670) has the molecular formula C16H34CaO2
and a molecular weight of 298.52 g/mol. Its IUPAC name is calcium bis(octan-1-olate).
Molecular Properties
| Compound Name | calcium bis(octan-1-olate) |
| PubChem CID | 87749670 |
| Molecular Formula | C16H34CaO2 |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | calcium bis(octan-1-olate) |
| SMILES | CCCCCCCC[O-].CCCCCCCC[O-].[Ca+2] |
| InChI | InChI=1S/2C8H17O.Ca/c2*1-2-3-4-5-6-7-8-9;/h2*2-8H2,1H3;/q2*-1;+2 |
| InChIKey | YBGHFLPNIGPGHX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(octan-1-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(octan-1-olate)?
The IUPAC name of calcium bis(octan-1-olate) (CID 87749670) is calcium bis(octan-1-olate).
What is the SMILES notation for calcium bis(octan-1-olate)?
The canonical SMILES for calcium bis(octan-1-olate) is CCCCCCCC[O-].CCCCCCCC[O-].[Ca+2].
What is the InChIKey of calcium bis(octan-1-olate)?
The InChIKey is YBGHFLPNIGPGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17O.Ca/c2*1-2-3-4-5-6-7-8-9;/h2*2-8H2,1H3;/q2*-1;+2.
What are the key properties of calcium bis(octan-1-olate)?
calcium bis(octan-1-olate) has a molecular weight of 298.52 g/mol, XLogP of 3.03, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(octan-1-olate) is sourced from PubChem (CID 87749670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).