About magnesium;butane;pentan-1-olate
magnesium;butane;pentan-1-olate (PubChem CID 141190772) has the molecular formula C9H20MgO
and a molecular weight of 168.56 g/mol. Its IUPAC name is magnesium;butane;pentan-1-olate.
Molecular Properties
| Compound Name | magnesium;butane;pentan-1-olate |
| PubChem CID | 141190772 |
| Molecular Formula | C9H20MgO |
| Molecular Weight | 168.56 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | magnesium;butane;pentan-1-olate |
| SMILES | CCCCC[O-].[CH2-]CCC.[Mg+2] |
| InChI | InChI=1S/C5H11O.C4H9.Mg/c1-2-3-4-5-6;1-3-4-2;/h2-5H2,1H3;1,3-4H2,2H3;/q2*-1;+2 |
| InChIKey | RNYNECGQTVWHPX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;butane;pentan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;butane;pentan-1-olate?
The IUPAC name of magnesium;butane;pentan-1-olate (CID 141190772) is magnesium;butane;pentan-1-olate.
What is the SMILES notation for magnesium;butane;pentan-1-olate?
The canonical SMILES for magnesium;butane;pentan-1-olate is CCCCC[O-].[CH2-]CCC.[Mg+2].
What is the InChIKey of magnesium;butane;pentan-1-olate?
The InChIKey is RNYNECGQTVWHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O.C4H9.Mg/c1-2-3-4-5-6;1-3-4-2;/h2-5H2,1H3;1,3-4H2,2H3;/q2*-1;+2.
What are the key properties of magnesium;butane;pentan-1-olate?
magnesium;butane;pentan-1-olate has a molecular weight of 168.56 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;butane;pentan-1-olate is sourced from PubChem (CID 141190772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).